C14H15NO4 — CID 117174369
3-(morpholin-4-ylmethyl)-1-benzofuran-5-carboxylic acid (PubChem CID 117174369) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 3-(morpholin-4-ylmethyl)-1-benzofuran-5-carboxylic acid.
| Compound Name | 3-(morpholin-4-ylmethyl)-1-benzofuran-5-carboxylic acid |
|---|---|
| PubChem CID | 117174369 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 3-(morpholin-4-ylmethyl)-1-benzofuran-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2occ(CN3CCOCC3)c2c1 |
| InChI | InChI=1S/C14H15NO4/c16-14(17)10-1-2-13-12(7-10)11(9-19-13)8-15-3-5-18-6-4-15/h1-2,7,9H,3-6,8H2,(H,16,17) |
| InChIKey | ZHTUJCAGKKPKPQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |