C23H21NO6 — CID 1208316
[5-hydroxy-4-(morpholin-4-ylmethyl)-1-benzofuran-3-yl]-(5-methoxy-1-benzofuran-3-yl)methanone (PubChem CID 1208316) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is [5-hydroxy-4-(morpholin-4-ylmethyl)-1-benzofuran-3-yl]-(5-methoxy-1-benzofuran-3-yl)methanone.
| Compound Name | [5-hydroxy-4-(morpholin-4-ylmethyl)-1-benzofuran-3-yl]-(5-methoxy-1-benzofuran-3-yl)methanone |
|---|---|
| PubChem CID | 1208316 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | [5-hydroxy-4-(morpholin-4-ylmethyl)-1-benzofuran-3-yl]-(5-methoxy-1-benzofuran-3-yl)methanone |
| SMILES | COc1ccc2occ(C(=O)c3coc4ccc(O)c(CN5CCOCC5)c34)c2c1 |
| InChI | InChI=1S/C23H21NO6/c1-27-14-2-4-20-15(10-14)17(12-29-20)23(26)18-13-30-21-5-3-19(25)16(22(18)21)11-24-6-8-28-9-7-24/h2-5,10,12-13,25H,6-9,11H2,1H3 |
| InChIKey | KUHYIBPOSCZBNN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 85.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|