C23H26N2O3 — CID 2672032
7-methoxy-1-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]naphthalen-2-ol (PubChem CID 2672032) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 7-methoxy-1-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]naphthalen-2-ol.
| Compound Name | 7-methoxy-1-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 2672032 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 7-methoxy-1-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]naphthalen-2-ol |
| SMILES | COc1ccc(N2CCN(Cc3c(O)ccc4ccc(OC)cc34)CC2)cc1 |
| InChI | InChI=1S/C23H26N2O3/c1-27-19-8-5-18(6-9-19)25-13-11-24(12-14-25)16-22-21-15-20(28-2)7-3-17(21)4-10-23(22)26/h3-10,15,26H,11-14,16H2,1-2H3 |
| InChIKey | MVBQAFQMAJAANW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|