C18H23NO3 — CID 34894357
1-[[(2S)-2-ethylmorpholin-4-yl]methyl]-7-methoxynaphthalen-2-ol (PubChem CID 34894357) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-[[(2S)-2-ethylmorpholin-4-yl]methyl]-7-methoxynaphthalen-2-ol.
| Compound Name | 1-[[(2S)-2-ethylmorpholin-4-yl]methyl]-7-methoxynaphthalen-2-ol |
|---|---|
| PubChem CID | 34894357 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 1-[[(2S)-2-ethylmorpholin-4-yl]methyl]-7-methoxynaphthalen-2-ol |
| SMILES | CC[C@H]1CN(Cc2c(O)ccc3ccc(OC)cc23)CCO1 |
| InChI | InChI=1S/C18H23NO3/c1-3-14-11-19(8-9-22-14)12-17-16-10-15(21-2)6-4-13(16)5-7-18(17)20/h4-7,10,14,20H,3,8-9,11-12H2,1-2H3/t14-/m0/s1 |
| InChIKey | CNHGDQLCMUVKHI-AWEZNQCLSA-N |
| XLogP | 3.16 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|