C18H21NO4S — CID 9233693
methyl (2R)-4-[(2-hydroxy-7-methoxynaphthalen-1-yl)methyl]thiomorpholine-2-carboxylate (PubChem CID 9233693) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is methyl (2R)-4-[(2-hydroxy-7-methoxynaphthalen-1-yl)methyl]thiomorpholine-2-carboxylate.
| Compound Name | methyl (2R)-4-[(2-hydroxy-7-methoxynaphthalen-1-yl)methyl]thiomorpholine-2-carboxylate |
|---|---|
| PubChem CID | 9233693 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | methyl (2R)-4-[(2-hydroxy-7-methoxynaphthalen-1-yl)methyl]thiomorpholine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CN(Cc2c(O)ccc3ccc(OC)cc23)CCS1 |
| InChI | InChI=1S/C18H21NO4S/c1-22-13-5-3-12-4-6-16(20)15(14(12)9-13)10-19-7-8-24-17(11-19)18(21)23-2/h3-6,9,17,20H,7-8,10-11H2,1-2H3/t17-/m1/s1 |
| InChIKey | LIDREWSHFISVSA-QGZVFWFLSA-N |
| XLogP | 2.64 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|