C29H27F3N2O5 — CID 95399484
7-hydroxy-3-(4-methoxyphenyl)-8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-2-(trifluoromethyl)chromen-4-one (PubChem CID 95399484) has the molecular formula C29H27F3N2O5 and a molecular weight of 540.54 g/mol. Its IUPAC name is 7-hydroxy-3-(4-methoxyphenyl)-8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 7-hydroxy-3-(4-methoxyphenyl)-8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 95399484 |
| Molecular Formula | C29H27F3N2O5 |
| Molecular Weight | 540.54 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | 7-hydroxy-3-(4-methoxyphenyl)-8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-2-(trifluoromethyl)chromen-4-one |
| SMILES | COc1ccc(-c2c(C(F)(F)F)oc3c(CN4CCN(c5ccc(OC)cc5)CC4)c(O)ccc3c2=O)cc1 |
| InChI | InChI=1S/C29H27F3N2O5/c1-37-20-7-3-18(4-8-20)25-26(36)22-11-12-24(35)23(27(22)39-28(25)29(30,31)32)17-33-13-15-34(16-14-33)19-5-9-21(38-2)10-6-19/h3-12,35H,13-17H2,1-2H3 |
| InChIKey | MNLKLVRCZQIFFC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.54 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|