C25H26F3NO4 — CID 110275701
8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxy-3-(2-methoxyphenyl)-2-(trifluoromethyl)chromen-4-one (PubChem CID 110275701) has the molecular formula C25H26F3NO4 and a molecular weight of 461.48 g/mol. Its IUPAC name is 8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxy-3-(2-methoxyphenyl)-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxy-3-(2-methoxyphenyl)-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 110275701 |
| Molecular Formula | C25H26F3NO4 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 8-[(3,5-dimethylpiperidin-1-yl)methyl]-7-hydroxy-3-(2-methoxyphenyl)-2-(trifluoromethyl)chromen-4-one |
| SMILES | COc1ccccc1-c1c(C(F)(F)F)oc2c(CN3CC(C)CC(C)C3)c(O)ccc2c1=O |
| InChI | InChI=1S/C25H26F3NO4/c1-14-10-15(2)12-29(11-14)13-18-19(30)9-8-17-22(31)21(16-6-4-5-7-20(16)32-3)24(25(26,27)28)33-23(17)18/h4-9,14-15,30H,10-13H2,1-3H3 |
| InChIKey | FBVAKXPLAXZGCW-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|