C22H20BrF3N2O4 — CID 5322267
3-(2-bromophenoxy)-7-hydroxy-8-[(4-methylpiperazin-1-yl)methyl]-2-(trifluoromethyl)chromen-4-one (PubChem CID 5322267) has the molecular formula C22H20BrF3N2O4 and a molecular weight of 513.31 g/mol. Its IUPAC name is 3-(2-bromophenoxy)-7-hydroxy-8-[(4-methylpiperazin-1-yl)methyl]-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 3-(2-bromophenoxy)-7-hydroxy-8-[(4-methylpiperazin-1-yl)methyl]-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 5322267 |
| Molecular Formula | C22H20BrF3N2O4 |
| Molecular Weight | 513.31 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | 3-(2-bromophenoxy)-7-hydroxy-8-[(4-methylpiperazin-1-yl)methyl]-2-(trifluoromethyl)chromen-4-one |
| SMILES | CN1CCN(Cc2c(O)ccc3c(=O)c(Oc4ccccc4Br)c(C(F)(F)F)oc23)CC1 |
| InChI | InChI=1S/C22H20BrF3N2O4/c1-27-8-10-28(11-9-27)12-14-16(29)7-6-13-18(30)20(21(22(24,25)26)32-19(13)14)31-17-5-3-2-4-15(17)23/h2-7,29H,8-12H2,1H3 |
| InChIKey | PTCZQZLXOVPASA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.31 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|