C24H24F3NO4 — CID 5322295
7-hydroxy-3-(3-methylphenoxy)-8-[(4-methylpiperidin-1-yl)methyl]-2-(trifluoromethyl)chromen-4-one (PubChem CID 5322295) has the molecular formula C24H24F3NO4 and a molecular weight of 447.45 g/mol. Its IUPAC name is 7-hydroxy-3-(3-methylphenoxy)-8-[(4-methylpiperidin-1-yl)methyl]-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 7-hydroxy-3-(3-methylphenoxy)-8-[(4-methylpiperidin-1-yl)methyl]-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 5322295 |
| Molecular Formula | C24H24F3NO4 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 7-hydroxy-3-(3-methylphenoxy)-8-[(4-methylpiperidin-1-yl)methyl]-2-(trifluoromethyl)chromen-4-one |
| SMILES | Cc1cccc(Oc2c(C(F)(F)F)oc3c(CN4CCC(C)CC4)c(O)ccc3c2=O)c1 |
| InChI | InChI=1S/C24H24F3NO4/c1-14-8-10-28(11-9-14)13-18-19(29)7-6-17-20(30)22(23(24(25,26)27)32-21(17)18)31-16-5-3-4-15(2)12-16/h3-7,12,14,29H,8-11,13H2,1-2H3 |
| InChIKey | HCHHQTIBQNVNLH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|