C19H13F3O6 — CID 7140143
2-[3-(3-methylphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl]oxyacetic acid (PubChem CID 7140143) has the molecular formula C19H13F3O6 and a molecular weight of 394.30 g/mol. Its IUPAC name is 2-[3-(3-methylphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl]oxyacetic acid.
| Compound Name | 2-[3-(3-methylphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl]oxyacetic acid |
|---|---|
| PubChem CID | 7140143 |
| Molecular Formula | C19H13F3O6 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 2-[3-(3-methylphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl]oxyacetic acid |
| SMILES | Cc1cccc(Oc2c(C(F)(F)F)oc3cc(OCC(=O)O)ccc3c2=O)c1 |
| InChI | InChI=1S/C19H13F3O6/c1-10-3-2-4-12(7-10)27-17-16(25)13-6-5-11(26-9-15(23)24)8-14(13)28-18(17)19(20,21)22/h2-8H,9H2,1H3,(H,23,24) |
| InChIKey | MTWSPFBYFQTIQF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |