C26H19F3O8 — CID 2023175
[3-(3-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3,4-dimethoxybenzoate (PubChem CID 2023175) has the molecular formula C26H19F3O8 and a molecular weight of 516.42 g/mol. Its IUPAC name is [3-(3-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3,4-dimethoxybenzoate.
| Compound Name | [3-(3-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 2023175 |
| Molecular Formula | C26H19F3O8 |
| Molecular Weight | 516.42 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | [3-(3-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 3,4-dimethoxybenzoate |
| SMILES | COc1cccc(Oc2c(C(F)(F)F)oc3cc(OC(=O)c4ccc(OC)c(OC)c4)ccc3c2=O)c1 |
| InChI | InChI=1S/C26H19F3O8/c1-32-15-5-4-6-16(12-15)35-23-22(30)18-9-8-17(13-20(18)37-24(23)26(27,28)29)36-25(31)14-7-10-19(33-2)21(11-14)34-3/h4-13H,1-3H3 |
| InChIKey | FMPTYTQWSKGHDG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.42 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|