C22H18F3NO7 — CID 1034256
[3-(3-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] morpholine-4-carboxylate (PubChem CID 1034256) has the molecular formula C22H18F3NO7 and a molecular weight of 465.38 g/mol. Its IUPAC name is [3-(3-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] morpholine-4-carboxylate.
| Compound Name | [3-(3-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 1034256 |
| Molecular Formula | C22H18F3NO7 |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | [3-(3-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] morpholine-4-carboxylate |
| SMILES | COc1cccc(Oc2c(C(F)(F)F)oc3cc(OC(=O)N4CCOCC4)ccc3c2=O)c1 |
| InChI | InChI=1S/C22H18F3NO7/c1-29-13-3-2-4-14(11-13)31-19-18(27)16-6-5-15(12-17(16)33-20(19)22(23,24)25)32-21(28)26-7-9-30-10-8-26/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | GKKSNTSXKCKVGJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 87.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |