C22H17F3NO7- — CID 22303341
2-[3-(3-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl]morpholine-4-carboxylate (PubChem CID 22303341) has the molecular formula C22H17F3NO7- and a molecular weight of 464.37 g/mol. Its IUPAC name is 2-[3-(3-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl]morpholine-4-carboxylate.
| Compound Name | 2-[3-(3-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 22303341 |
| Molecular Formula | C22H17F3NO7- |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 2-[3-(3-methoxyphenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl]morpholine-4-carboxylate |
| SMILES | COc1cccc(Oc2c(C(F)(F)F)oc3cc(C4CN(C(=O)[O-])CCO4)ccc3c2=O)c1 |
| InChI | InChI=1S/C22H18F3NO7/c1-30-13-3-2-4-14(10-13)32-19-18(27)15-6-5-12(9-16(15)33-20(19)22(23,24)25)17-11-26(21(28)29)7-8-31-17/h2-6,9-10,17H,7-8,11H2,1H3,(H,28,29)/p-1 |
| InChIKey | FDTTWNIUBOFECE-UHFFFAOYSA-M |
| XLogP | 3.33 |
| TPSA | 101.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |