About [4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl] 3-methoxybenzoate
[4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl] 3-methoxybenzoate (PubChem CID 2044468) has the molecular formula C24H15F3O5
and a molecular weight of 440.37 g/mol. Its IUPAC name is [4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl] 3-methoxybenzoate.
Molecular Properties
| Compound Name | [4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl] 3-methoxybenzoate |
| PubChem CID | 2044468 |
| Molecular Formula | C24H15F3O5 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | [4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc3c(=O)c(-c4ccccc4)c(C(F)(F)F)oc3c2)c1 |
| InChI | InChI=1S/C24H15F3O5/c1-30-16-9-5-8-15(12-16)23(29)31-17-10-11-18-19(13-17)32-22(24(25,26)27)20(21(18)28)14-6-3-2-4-7-14/h2-13H,1H3 |
| InChIKey | AQSPCSWKMVLPNQ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl] 3-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl] 3-methoxybenzoate?
The IUPAC name of [4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl] 3-methoxybenzoate (CID 2044468) is [4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl] 3-methoxybenzoate.
What is the SMILES notation for [4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl] 3-methoxybenzoate?
The canonical SMILES for [4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl] 3-methoxybenzoate is COc1cccc(C(=O)Oc2ccc3c(=O)c(-c4ccccc4)c(C(F)(F)F)oc3c2)c1.
What is the InChIKey of [4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl] 3-methoxybenzoate?
The InChIKey is AQSPCSWKMVLPNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15F3O5/c1-30-16-9-5-8-15(12-16)23(29)31-17-10-11-18-19(13-17)32-22(24(25,26)27)20(21(18)28)14-6-3-2-4-7-14/h2-13H,1H3.
What are the key properties of [4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl] 3-methoxybenzoate?
[4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl] 3-methoxybenzoate has a molecular weight of 440.37 g/mol, XLogP of 5.71, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-oxo-3-phenyl-2-(trifluoromethyl)chromen-7-yl] 3-methoxybenzoate is sourced from PubChem (CID 2044468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).