C31H24F3NO8 — CID 4282780
[3-(3,4-dimethoxyphenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-butan-2-yl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 4282780) has the molecular formula C31H24F3NO8 and a molecular weight of 595.53 g/mol. Its IUPAC name is [3-(3,4-dimethoxyphenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-butan-2-yl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [3-(3,4-dimethoxyphenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-butan-2-yl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 4282780 |
| Molecular Formula | C31H24F3NO8 |
| Molecular Weight | 595.53 g/mol |
| Exact Mass | 595.15 |
| IUPAC Name | [3-(3,4-dimethoxyphenyl)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2-butan-2-yl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCC(C)N1C(=O)c2ccc(C(=O)Oc3ccc4c(=O)c(-c5ccc(OC)c(OC)c5)c(C(F)(F)F)oc4c3)cc2C1=O |
| InChI | InChI=1S/C31H24F3NO8/c1-5-15(2)35-28(37)19-9-6-17(12-21(19)29(35)38)30(39)42-18-8-10-20-23(14-18)43-27(31(32,33)34)25(26(20)36)16-7-11-22(40-3)24(13-16)41-4/h6-15H,5H2,1-4H3 |
| InChIKey | PMULNQMNFXXQFD-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 112.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.53 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|