C29H23NO7 — CID 2240868
[3-(3-methylphenoxy)-4-oxochromen-7-yl] 2-[(2R)-butan-2-yl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 2240868) has the molecular formula C29H23NO7 and a molecular weight of 497.50 g/mol. Its IUPAC name is [3-(3-methylphenoxy)-4-oxochromen-7-yl] 2-[(2R)-butan-2-yl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [3-(3-methylphenoxy)-4-oxochromen-7-yl] 2-[(2R)-butan-2-yl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 2240868 |
| Molecular Formula | C29H23NO7 |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | [3-(3-methylphenoxy)-4-oxochromen-7-yl] 2-[(2R)-butan-2-yl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC[C@@H](C)N1C(=O)c2ccc(C(=O)Oc3ccc4c(=O)c(Oc5cccc(C)c5)coc4c3)cc2C1=O |
| InChI | InChI=1S/C29H23NO7/c1-4-17(3)30-27(32)21-10-8-18(13-23(21)28(30)33)29(34)37-20-9-11-22-24(14-20)35-15-25(26(22)31)36-19-7-5-6-16(2)12-19/h5-15,17H,4H2,1-3H3/t17-/m1/s1 |
| InChIKey | BRPUZUURSQGJKQ-QGZVFWFLSA-N |
| XLogP | 5.51 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|