About (4-oxo-3-phenoxychromen-7-yl) 2-aminopropanoate
(4-oxo-3-phenoxychromen-7-yl) 2-aminopropanoate (PubChem CID 21204069) has the molecular formula C18H15NO5
and a molecular weight of 325.32 g/mol. Its IUPAC name is (4-oxo-3-phenoxychromen-7-yl) 2-aminopropanoate.
Molecular Properties
| Compound Name | (4-oxo-3-phenoxychromen-7-yl) 2-aminopropanoate |
| PubChem CID | 21204069 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (4-oxo-3-phenoxychromen-7-yl) 2-aminopropanoate |
| SMILES | CC(N)C(=O)Oc1ccc2c(=O)c(Oc3ccccc3)coc2c1 |
| InChI | InChI=1S/C18H15NO5/c1-11(19)18(21)24-13-7-8-14-15(9-13)22-10-16(17(14)20)23-12-5-3-2-4-6-12/h2-11H,19H2,1H3 |
| InChIKey | QDPHDMMWINZJGT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-oxo-3-phenoxychromen-7-yl) 2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxo-3-phenoxychromen-7-yl) 2-aminopropanoate?
The IUPAC name of (4-oxo-3-phenoxychromen-7-yl) 2-aminopropanoate (CID 21204069) is (4-oxo-3-phenoxychromen-7-yl) 2-aminopropanoate.
What is the SMILES notation for (4-oxo-3-phenoxychromen-7-yl) 2-aminopropanoate?
The canonical SMILES for (4-oxo-3-phenoxychromen-7-yl) 2-aminopropanoate is CC(N)C(=O)Oc1ccc2c(=O)c(Oc3ccccc3)coc2c1.
What is the InChIKey of (4-oxo-3-phenoxychromen-7-yl) 2-aminopropanoate?
The InChIKey is QDPHDMMWINZJGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO5/c1-11(19)18(21)24-13-7-8-14-15(9-13)22-10-16(17(14)20)23-12-5-3-2-4-6-12/h2-11H,19H2,1H3.
What are the key properties of (4-oxo-3-phenoxychromen-7-yl) 2-aminopropanoate?
(4-oxo-3-phenoxychromen-7-yl) 2-aminopropanoate has a molecular weight of 325.32 g/mol, XLogP of 2.84, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-3-phenoxychromen-7-yl) 2-aminopropanoate is sourced from PubChem (CID 21204069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).