C21H20O6 — CID 20984150
3-methyl-2-[3-(4-methylphenoxy)-4-oxochromen-7-yl]oxybutanoic acid (PubChem CID 20984150) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is 3-methyl-2-[3-(4-methylphenoxy)-4-oxochromen-7-yl]oxybutanoic acid.
| Compound Name | 3-methyl-2-[3-(4-methylphenoxy)-4-oxochromen-7-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 20984150 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 3-methyl-2-[3-(4-methylphenoxy)-4-oxochromen-7-yl]oxybutanoic acid |
| SMILES | Cc1ccc(Oc2coc3cc(OC(C(=O)O)C(C)C)ccc3c2=O)cc1 |
| InChI | InChI=1S/C21H20O6/c1-12(2)20(21(23)24)27-15-8-9-16-17(10-15)25-11-18(19(16)22)26-14-6-4-13(3)5-7-14/h4-12,20H,1-3H3,(H,23,24) |
| InChIKey | POSFGAWNZZDXPA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |