C22H22O6 — CID 20992793
2-[3-(2-ethylphenoxy)-4-oxochromen-7-yl]oxy-3-methylbutanoic acid (PubChem CID 20992793) has the molecular formula C22H22O6 and a molecular weight of 382.41 g/mol. Its IUPAC name is 2-[3-(2-ethylphenoxy)-4-oxochromen-7-yl]oxy-3-methylbutanoic acid.
| Compound Name | 2-[3-(2-ethylphenoxy)-4-oxochromen-7-yl]oxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 20992793 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-[3-(2-ethylphenoxy)-4-oxochromen-7-yl]oxy-3-methylbutanoic acid |
| SMILES | CCc1ccccc1Oc1coc2cc(OC(C(=O)O)C(C)C)ccc2c1=O |
| InChI | InChI=1S/C22H22O6/c1-4-14-7-5-6-8-17(14)28-19-12-26-18-11-15(9-10-16(18)20(19)23)27-21(13(2)3)22(24)25/h5-13,21H,4H2,1-3H3,(H,24,25) |
| InChIKey | UGVJBXSVPOSGIK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |