3-[3-(2-ethoxyphenoxy)-4-oxochromen-7-yl]oxypropanoic acid

C20H18O7 — CID 22682676

IUPAC3-[3-(2-ethoxyphenoxy)-4-oxochromen-7-yl]oxypropanoic acid
SMILESCCOc1ccccc1Oc1coc2cc(OCCC(=O)O)ccc2c1=O
InChIInChI=1S/C20H18O7/c1-2-24-15-5-3-4-6-16(15)27-18-12-26-17-11-13(25-10-9-19(21)22)7-8-14(17)20(18)23/h3-8,11-12H,2,9-10H2,1H3,(H,21,22)
InChIKeyQGURJIHVNHSWHO-UHFFFAOYSA-N
MW370.36 g/mol
LogP3.84
Rot. Bonds8

About 3-[3-(2-ethoxyphenoxy)-4-oxochromen-7-yl]oxypropanoic acid

3-[3-(2-ethoxyphenoxy)-4-oxochromen-7-yl]oxypropanoic acid (PubChem CID 22682676) has the molecular formula C20H18O7 and a molecular weight of 370.36 g/mol. Its IUPAC name is 3-[3-(2-ethoxyphenoxy)-4-oxochromen-7-yl]oxypropanoic acid.

Molecular Properties

Compound Name3-[3-(2-ethoxyphenoxy)-4-oxochromen-7-yl]oxypropanoic acid
PubChem CID22682676
Molecular FormulaC20H18O7
Molecular Weight370.36 g/mol
Exact Mass370.11
IUPAC Name3-[3-(2-ethoxyphenoxy)-4-oxochromen-7-yl]oxypropanoic acid
SMILESCCOc1ccccc1Oc1coc2cc(OCCC(=O)O)ccc2c1=O
InChIInChI=1S/C20H18O7/c1-2-24-15-5-3-4-6-16(15)27-18-12-26-17-11-13(25-10-9-19(21)22)7-8-14(17)20(18)23/h3-8,11-12H,2,9-10H2,1H3,(H,21,22)
InChIKeyQGURJIHVNHSWHO-UHFFFAOYSA-N
XLogP3.84
TPSA95.20 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms27
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500370.36
LogP ≤ 53.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 3-[3-(2-ethoxyphenoxy)-4-oxochromen-7-yl]oxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[3-(2-ethoxyphenoxy)-4-oxochromen-7-yl]oxypropanoic acid?
The IUPAC name of 3-[3-(2-ethoxyphenoxy)-4-oxochromen-7-yl]oxypropanoic acid (CID 22682676) is 3-[3-(2-ethoxyphenoxy)-4-oxochromen-7-yl]oxypropanoic acid.
What is the SMILES notation for 3-[3-(2-ethoxyphenoxy)-4-oxochromen-7-yl]oxypropanoic acid?
The canonical SMILES for 3-[3-(2-ethoxyphenoxy)-4-oxochromen-7-yl]oxypropanoic acid is CCOc1ccccc1Oc1coc2cc(OCCC(=O)O)ccc2c1=O.
What is the InChIKey of 3-[3-(2-ethoxyphenoxy)-4-oxochromen-7-yl]oxypropanoic acid?
The InChIKey is QGURJIHVNHSWHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18O7/c1-2-24-15-5-3-4-6-16(15)27-18-12-26-17-11-13(25-10-9-19(21)22)7-8-14(17)20(18)23/h3-8,11-12H,2,9-10H2,1H3,(H,21,22).
What are the key properties of 3-[3-(2-ethoxyphenoxy)-4-oxochromen-7-yl]oxypropanoic acid?
3-[3-(2-ethoxyphenoxy)-4-oxochromen-7-yl]oxypropanoic acid has a molecular weight of 370.36 g/mol, XLogP of 3.84, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2-ethoxyphenoxy)-4-oxochromen-7-yl]oxypropanoic acid is sourced from PubChem (CID 22682676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).