C21H18NO8- — CID 7139399
2-[[2-[3-(2-ethoxyphenoxy)-4-oxochromen-7-yl]oxyacetyl]amino]acetate (PubChem CID 7139399) has the molecular formula C21H18NO8- and a molecular weight of 412.37 g/mol. Its IUPAC name is 2-[[2-[3-(2-ethoxyphenoxy)-4-oxochromen-7-yl]oxyacetyl]amino]acetate.
| Compound Name | 2-[[2-[3-(2-ethoxyphenoxy)-4-oxochromen-7-yl]oxyacetyl]amino]acetate |
|---|---|
| PubChem CID | 7139399 |
| Molecular Formula | C21H18NO8- |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 2-[[2-[3-(2-ethoxyphenoxy)-4-oxochromen-7-yl]oxyacetyl]amino]acetate |
| SMILES | CCOc1ccccc1Oc1coc2cc(OCC(=O)NCC(=O)[O-])ccc2c1=O |
| InChI | InChI=1S/C21H19NO8/c1-2-27-15-5-3-4-6-16(15)30-18-11-29-17-9-13(7-8-14(17)21(18)26)28-12-19(23)22-10-20(24)25/h3-9,11H,2,10,12H2,1H3,(H,22,23)(H,24,25)/p-1 |
| InChIKey | PMPJMTPAMMMKDQ-UHFFFAOYSA-M |
| XLogP | 1.23 |
| TPSA | 127.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |