C18H13O6- — CID 4672101
2-[3-(2-methoxyphenyl)-4-oxochromen-7-yl]oxyacetate (PubChem CID 4672101) has the molecular formula C18H13O6- and a molecular weight of 325.30 g/mol. Its IUPAC name is 2-[3-(2-methoxyphenyl)-4-oxochromen-7-yl]oxyacetate.
| Compound Name | 2-[3-(2-methoxyphenyl)-4-oxochromen-7-yl]oxyacetate |
|---|---|
| PubChem CID | 4672101 |
| Molecular Formula | C18H13O6- |
| Molecular Weight | 325.30 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2-[3-(2-methoxyphenyl)-4-oxochromen-7-yl]oxyacetate |
| SMILES | COc1ccccc1-c1coc2cc(OCC(=O)[O-])ccc2c1=O |
| InChI | InChI=1S/C18H14O6/c1-22-15-5-3-2-4-12(15)14-9-24-16-8-11(23-10-17(19)20)6-7-13(16)18(14)21/h2-9H,10H2,1H3,(H,19,20)/p-1 |
| InChIKey | XEZQQAYPTKXYPI-UHFFFAOYSA-M |
| XLogP | 1.60 |
| TPSA | 88.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |