C23H13F5O4 — CID 2038118
3-(2-methoxyphenyl)-7-[(2,3,4,5,6-pentafluorophenyl)methoxy]chromen-4-one (PubChem CID 2038118) has the molecular formula C23H13F5O4 and a molecular weight of 448.34 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-7-[(2,3,4,5,6-pentafluorophenyl)methoxy]chromen-4-one.
| Compound Name | 3-(2-methoxyphenyl)-7-[(2,3,4,5,6-pentafluorophenyl)methoxy]chromen-4-one |
|---|---|
| PubChem CID | 2038118 |
| Molecular Formula | C23H13F5O4 |
| Molecular Weight | 448.34 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 3-(2-methoxyphenyl)-7-[(2,3,4,5,6-pentafluorophenyl)methoxy]chromen-4-one |
| SMILES | COc1ccccc1-c1coc2cc(OCc3c(F)c(F)c(F)c(F)c3F)ccc2c1=O |
| InChI | InChI=1S/C23H13F5O4/c1-30-16-5-3-2-4-12(16)14-9-32-17-8-11(6-7-13(17)23(14)29)31-10-15-18(24)20(26)22(28)21(27)19(15)25/h2-9H,10H2,1H3 |
| InChIKey | YBBYJSJJNWEVQW-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.34 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|