C23H17FO7S — CID 55598116
(4-oxo-3-phenylchromen-7-yl) 2-fluoro-4,5-dimethoxybenzenesulfonate (PubChem CID 55598116) has the molecular formula C23H17FO7S and a molecular weight of 456.45 g/mol. Its IUPAC name is (4-oxo-3-phenylchromen-7-yl) 2-fluoro-4,5-dimethoxybenzenesulfonate.
| Compound Name | (4-oxo-3-phenylchromen-7-yl) 2-fluoro-4,5-dimethoxybenzenesulfonate |
|---|---|
| PubChem CID | 55598116 |
| Molecular Formula | C23H17FO7S |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | (4-oxo-3-phenylchromen-7-yl) 2-fluoro-4,5-dimethoxybenzenesulfonate |
| SMILES | COc1cc(F)c(S(=O)(=O)Oc2ccc3c(=O)c(-c4ccccc4)coc3c2)cc1OC |
| InChI | InChI=1S/C23H17FO7S/c1-28-20-11-18(24)22(12-21(20)29-2)32(26,27)31-15-8-9-16-19(10-15)30-13-17(23(16)25)14-6-4-3-5-7-14/h3-13H,1-2H3 |
| InChIKey | BKFWHOLTNVWPDH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|