C14H12F2O5S — CID 35289930
(2-fluorophenyl) 2-fluoro-4,5-dimethoxybenzenesulfonate (PubChem CID 35289930) has the molecular formula C14H12F2O5S and a molecular weight of 330.31 g/mol. Its IUPAC name is (2-fluorophenyl) 2-fluoro-4,5-dimethoxybenzenesulfonate.
| Compound Name | (2-fluorophenyl) 2-fluoro-4,5-dimethoxybenzenesulfonate |
|---|---|
| PubChem CID | 35289930 |
| Molecular Formula | C14H12F2O5S |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | (2-fluorophenyl) 2-fluoro-4,5-dimethoxybenzenesulfonate |
| SMILES | COc1cc(F)c(S(=O)(=O)Oc2ccccc2F)cc1OC |
| InChI | InChI=1S/C14H12F2O5S/c1-19-12-7-10(16)14(8-13(12)20-2)22(17,18)21-11-6-4-3-5-9(11)15/h3-8H,1-2H3 |
| InChIKey | CBPHDQUSYFUFND-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|