C14H11F3O4S — CID 30327256
(2-methoxy-4-methylphenyl) 2,3,4-trifluorobenzenesulfonate (PubChem CID 30327256) has the molecular formula C14H11F3O4S and a molecular weight of 332.30 g/mol. Its IUPAC name is (2-methoxy-4-methylphenyl) 2,3,4-trifluorobenzenesulfonate.
| Compound Name | (2-methoxy-4-methylphenyl) 2,3,4-trifluorobenzenesulfonate |
|---|---|
| PubChem CID | 30327256 |
| Molecular Formula | C14H11F3O4S |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | (2-methoxy-4-methylphenyl) 2,3,4-trifluorobenzenesulfonate |
| SMILES | COc1cc(C)ccc1OS(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H11F3O4S/c1-8-3-5-10(11(7-8)20-2)21-22(18,19)12-6-4-9(15)13(16)14(12)17/h3-7H,1-2H3 |
| InChIKey | NGZVZMTWEGPXRR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|