C13H9F4NO3S — CID 12016875
2,3,4-trifluoro-N-(3-fluoro-4-methoxyphenyl)benzenesulfonamide (PubChem CID 12016875) has the molecular formula C13H9F4NO3S and a molecular weight of 335.28 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-(3-fluoro-4-methoxyphenyl)benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-(3-fluoro-4-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 12016875 |
| Molecular Formula | C13H9F4NO3S |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 2,3,4-trifluoro-N-(3-fluoro-4-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(F)c(F)c2F)cc1F |
| InChI | InChI=1S/C13H9F4NO3S/c1-21-10-4-2-7(6-9(10)15)18-22(19,20)11-5-3-8(14)12(16)13(11)17/h2-6,18H,1H3 |
| InChIKey | AYUOWVFSPKPEMA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|