C13H10F3NO3S — CID 28560651
N-(3,4-difluorophenyl)-5-fluoro-2-methoxybenzenesulfonamide (PubChem CID 28560651) has the molecular formula C13H10F3NO3S and a molecular weight of 317.29 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-5-fluoro-2-methoxybenzenesulfonamide.
| Compound Name | N-(3,4-difluorophenyl)-5-fluoro-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 28560651 |
| Molecular Formula | C13H10F3NO3S |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | N-(3,4-difluorophenyl)-5-fluoro-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(F)cc1S(=O)(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H10F3NO3S/c1-20-12-5-2-8(14)6-13(12)21(18,19)17-9-3-4-10(15)11(16)7-9/h2-7,17H,1H3 |
| InChIKey | DZVYLKFFCQZJFV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |