C14H8F5NO5S — CID 155578468
2,3,4,5-tetrafluoro-6-[(3-fluoro-4-methoxyphenyl)sulfamoyl]benzoic acid (PubChem CID 155578468) has the molecular formula C14H8F5NO5S and a molecular weight of 397.28 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-[(3-fluoro-4-methoxyphenyl)sulfamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrafluoro-6-[(3-fluoro-4-methoxyphenyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 155578468 |
| Molecular Formula | C14H8F5NO5S |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-[(3-fluoro-4-methoxyphenyl)sulfamoyl]benzoic acid |
| SMILES | COc1ccc(NS(=O)(=O)c2c(F)c(F)c(F)c(F)c2C(=O)O)cc1F |
| InChI | InChI=1S/C14H8F5NO5S/c1-25-7-3-2-5(4-6(7)15)20-26(23,24)13-8(14(21)22)9(16)10(17)11(18)12(13)19/h2-4,20H,1H3,(H,21,22) |
| InChIKey | SYPPQFUYUZAPJO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|