C15H13F2NO6S — CID 56808928
5-[(3,4-difluorophenyl)sulfamoyl]-2,3-dimethoxybenzoic acid (PubChem CID 56808928) has the molecular formula C15H13F2NO6S and a molecular weight of 373.33 g/mol. Its IUPAC name is 5-[(3,4-difluorophenyl)sulfamoyl]-2,3-dimethoxybenzoic acid.
| Compound Name | 5-[(3,4-difluorophenyl)sulfamoyl]-2,3-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 56808928 |
| Molecular Formula | C15H13F2NO6S |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 5-[(3,4-difluorophenyl)sulfamoyl]-2,3-dimethoxybenzoic acid |
| SMILES | COc1cc(S(=O)(=O)Nc2ccc(F)c(F)c2)cc(C(=O)O)c1OC |
| InChI | InChI=1S/C15H13F2NO6S/c1-23-13-7-9(6-10(15(19)20)14(13)24-2)25(21,22)18-8-3-4-11(16)12(17)5-8/h3-7,18H,1-2H3,(H,19,20) |
| InChIKey | WWVSZTAUEXNLTO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |