C11H13FN4O3S — CID 60808628
3-amino-N-(3-fluoro-4-methoxyphenyl)-1-methylpyrazole-4-sulfonamide (PubChem CID 60808628) has the molecular formula C11H13FN4O3S and a molecular weight of 300.32 g/mol. Its IUPAC name is 3-amino-N-(3-fluoro-4-methoxyphenyl)-1-methylpyrazole-4-sulfonamide.
| Compound Name | 3-amino-N-(3-fluoro-4-methoxyphenyl)-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60808628 |
| Molecular Formula | C11H13FN4O3S |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 3-amino-N-(3-fluoro-4-methoxyphenyl)-1-methylpyrazole-4-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cn(C)nc2N)cc1F |
| InChI | InChI=1S/C11H13FN4O3S/c1-16-6-10(11(13)14-16)20(17,18)15-7-3-4-9(19-2)8(12)5-7/h3-6,15H,1-2H3,(H2,13,14) |
| InChIKey | ALHLWVPZRMJUAO-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |