C12H10N6O2S — CID 107786922
3-amino-N-(3,4-dicyanophenyl)-1-methylpyrazole-4-sulfonamide (PubChem CID 107786922) has the molecular formula C12H10N6O2S and a molecular weight of 302.32 g/mol. Its IUPAC name is 3-amino-N-(3,4-dicyanophenyl)-1-methylpyrazole-4-sulfonamide.
| Compound Name | 3-amino-N-(3,4-dicyanophenyl)-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 107786922 |
| Molecular Formula | C12H10N6O2S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 3-amino-N-(3,4-dicyanophenyl)-1-methylpyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)Nc2ccc(C#N)c(C#N)c2)c(N)n1 |
| InChI | InChI=1S/C12H10N6O2S/c1-18-7-11(12(15)16-18)21(19,20)17-10-3-2-8(5-13)9(4-10)6-14/h2-4,7,17H,1H3,(H2,15,16) |
| InChIKey | OREPBINJQIEGTN-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 137.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |