C14H9N3O2S — CID 113220864
N-(3,4-dicyanophenyl)benzenesulfonamide (PubChem CID 113220864) has the molecular formula C14H9N3O2S and a molecular weight of 283.31 g/mol. Its IUPAC name is N-(3,4-dicyanophenyl)benzenesulfonamide.
| Compound Name | N-(3,4-dicyanophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 113220864 |
| Molecular Formula | C14H9N3O2S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | N-(3,4-dicyanophenyl)benzenesulfonamide |
| SMILES | N#Cc1ccc(NS(=O)(=O)c2ccccc2)cc1C#N |
| InChI | InChI=1S/C14H9N3O2S/c15-9-11-6-7-13(8-12(11)10-16)17-20(18,19)14-4-2-1-3-5-14/h1-8,17H |
| InChIKey | PXPSYZUVFIBSEV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |