C15H14ClN3O4S2 — CID 31782478
1-N-(4-chloro-3-cyanophenyl)-3-N,3-N-dimethylbenzene-1,3-disulfonamide (PubChem CID 31782478) has the molecular formula C15H14ClN3O4S2 and a molecular weight of 399.88 g/mol. Its IUPAC name is 1-N-(4-chloro-3-cyanophenyl)-3-N,3-N-dimethylbenzene-1,3-disulfonamide.
| Compound Name | 1-N-(4-chloro-3-cyanophenyl)-3-N,3-N-dimethylbenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 31782478 |
| Molecular Formula | C15H14ClN3O4S2 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | 1-N-(4-chloro-3-cyanophenyl)-3-N,3-N-dimethylbenzene-1,3-disulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(S(=O)(=O)Nc2ccc(Cl)c(C#N)c2)c1 |
| InChI | InChI=1S/C15H14ClN3O4S2/c1-19(2)25(22,23)14-5-3-4-13(9-14)24(20,21)18-12-6-7-15(16)11(8-12)10-17/h3-9,18H,1-2H3 |
| InChIKey | LETDDVMDDYDGPK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |