C16H11ClN4O2S — CID 47062851
4-chloro-3-cyano-N-[3-(1H-pyrazol-5-yl)phenyl]benzenesulfonamide (PubChem CID 47062851) has the molecular formula C16H11ClN4O2S and a molecular weight of 358.81 g/mol. Its IUPAC name is 4-chloro-3-cyano-N-[3-(1H-pyrazol-5-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-chloro-3-cyano-N-[3-(1H-pyrazol-5-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 47062851 |
| Molecular Formula | C16H11ClN4O2S |
| Molecular Weight | 358.81 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 4-chloro-3-cyano-N-[3-(1H-pyrazol-5-yl)phenyl]benzenesulfonamide |
| SMILES | N#Cc1cc(S(=O)(=O)Nc2cccc(-c3ccn[nH]3)c2)ccc1Cl |
| InChI | InChI=1S/C16H11ClN4O2S/c17-15-5-4-14(9-12(15)10-18)24(22,23)21-13-3-1-2-11(8-13)16-6-7-19-20-16/h1-9,21H,(H,19,20) |
| InChIKey | COVXWWGCFCLEIR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.81 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |