C16H13Cl2N3 — CID 43745380
N-[(2,6-dichlorophenyl)methyl]-3-(1H-pyrazol-5-yl)aniline (PubChem CID 43745380) has the molecular formula C16H13Cl2N3 and a molecular weight of 318.21 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methyl]-3-(1H-pyrazol-5-yl)aniline.
| Compound Name | N-[(2,6-dichlorophenyl)methyl]-3-(1H-pyrazol-5-yl)aniline |
|---|---|
| PubChem CID | 43745380 |
| Molecular Formula | C16H13Cl2N3 |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methyl]-3-(1H-pyrazol-5-yl)aniline |
| SMILES | Clc1cccc(Cl)c1CNc1cccc(-c2ccn[nH]2)c1 |
| InChI | InChI=1S/C16H13Cl2N3/c17-14-5-2-6-15(18)13(14)10-19-12-4-1-3-11(9-12)16-7-8-20-21-16/h1-9,19H,10H2,(H,20,21) |
| InChIKey | DFTYGDOTXNGKKT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |