C17H17N3S — CID 43745309
N-[(4-methylsulfanylphenyl)methyl]-3-(1H-pyrazol-5-yl)aniline (PubChem CID 43745309) has the molecular formula C17H17N3S and a molecular weight of 295.41 g/mol. Its IUPAC name is N-[(4-methylsulfanylphenyl)methyl]-3-(1H-pyrazol-5-yl)aniline.
| Compound Name | N-[(4-methylsulfanylphenyl)methyl]-3-(1H-pyrazol-5-yl)aniline |
|---|---|
| PubChem CID | 43745309 |
| Molecular Formula | C17H17N3S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N-[(4-methylsulfanylphenyl)methyl]-3-(1H-pyrazol-5-yl)aniline |
| SMILES | CSc1ccc(CNc2cccc(-c3ccn[nH]3)c2)cc1 |
| InChI | InChI=1S/C17H17N3S/c1-21-16-7-5-13(6-8-16)12-18-15-4-2-3-14(11-15)17-9-10-19-20-17/h2-11,18H,12H2,1H3,(H,19,20) |
| InChIKey | XDJHKALVUBSZRS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |