C17H16FN3 — CID 103947437
N-[(5-fluoro-2-methylphenyl)methyl]-3-(1H-pyrazol-5-yl)aniline (PubChem CID 103947437) has the molecular formula C17H16FN3 and a molecular weight of 281.33 g/mol. Its IUPAC name is N-[(5-fluoro-2-methylphenyl)methyl]-3-(1H-pyrazol-5-yl)aniline.
| Compound Name | N-[(5-fluoro-2-methylphenyl)methyl]-3-(1H-pyrazol-5-yl)aniline |
|---|---|
| PubChem CID | 103947437 |
| Molecular Formula | C17H16FN3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | N-[(5-fluoro-2-methylphenyl)methyl]-3-(1H-pyrazol-5-yl)aniline |
| SMILES | Cc1ccc(F)cc1CNc1cccc(-c2ccn[nH]2)c1 |
| InChI | InChI=1S/C17H16FN3/c1-12-5-6-15(18)9-14(12)11-19-16-4-2-3-13(10-16)17-7-8-20-21-17/h2-10,19H,11H2,1H3,(H,20,21) |
| InChIKey | UEGXQMBNPQRGFL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |