C15H22N4 — CID 107445250
N'-tert-butyl-N-[3-(1H-pyrazol-5-yl)phenyl]ethane-1,2-diamine (PubChem CID 107445250) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is N'-tert-butyl-N-[3-(1H-pyrazol-5-yl)phenyl]ethane-1,2-diamine.
| Compound Name | N'-tert-butyl-N-[3-(1H-pyrazol-5-yl)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 107445250 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | N'-tert-butyl-N-[3-(1H-pyrazol-5-yl)phenyl]ethane-1,2-diamine |
| SMILES | CC(C)(C)NCCNc1cccc(-c2ccn[nH]2)c1 |
| InChI | InChI=1S/C15H22N4/c1-15(2,3)17-10-9-16-13-6-4-5-12(11-13)14-7-8-18-19-14/h4-8,11,16-17H,9-10H2,1-3H3,(H,18,19) |
| InChIKey | FZZNECRKLHMWTD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|