C15H11Cl2N3O2S — CID 72547025
3,5-dichloro-N-[4-(1H-pyrazol-5-yl)phenyl]benzenesulfonamide (PubChem CID 72547025) has the molecular formula C15H11Cl2N3O2S and a molecular weight of 368.25 g/mol. Its IUPAC name is 3,5-dichloro-N-[4-(1H-pyrazol-5-yl)phenyl]benzenesulfonamide.
| Compound Name | 3,5-dichloro-N-[4-(1H-pyrazol-5-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 72547025 |
| Molecular Formula | C15H11Cl2N3O2S |
| Molecular Weight | 368.25 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 3,5-dichloro-N-[4-(1H-pyrazol-5-yl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-c2ccn[nH]2)cc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H11Cl2N3O2S/c16-11-7-12(17)9-14(8-11)23(21,22)20-13-3-1-10(2-4-13)15-5-6-18-19-15/h1-9,20H,(H,18,19) |
| InChIKey | VTPLTXZKMKTFBQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |