C11H9Cl2N3O2S — CID 55025804
N-(6-amino-3-pyridinyl)-3,5-dichlorobenzenesulfonamide (PubChem CID 55025804) has the molecular formula C11H9Cl2N3O2S and a molecular weight of 318.19 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-3,5-dichlorobenzenesulfonamide.
| Compound Name | N-(6-amino-3-pyridinyl)-3,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 55025804 |
| Molecular Formula | C11H9Cl2N3O2S |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-3,5-dichlorobenzenesulfonamide |
| SMILES | Nc1ccc(NS(=O)(=O)c2cc(Cl)cc(Cl)c2)cn1 |
| InChI | InChI=1S/C11H9Cl2N3O2S/c12-7-3-8(13)5-10(4-7)19(17,18)16-9-1-2-11(14)15-6-9/h1-6,16H,(H2,14,15) |
| InChIKey | BWILYSXIACLIRI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |