C12H10Cl2N4O — CID 107654059
1-(6-amino-3-pyridinyl)-3-(3,5-dichlorophenyl)urea (PubChem CID 107654059) has the molecular formula C12H10Cl2N4O and a molecular weight of 297.15 g/mol. Its IUPAC name is 1-(6-amino-3-pyridinyl)-3-(3,5-dichlorophenyl)urea.
| Compound Name | 1-(6-amino-3-pyridinyl)-3-(3,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 107654059 |
| Molecular Formula | C12H10Cl2N4O |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 1-(6-amino-3-pyridinyl)-3-(3,5-dichlorophenyl)urea |
| SMILES | Nc1ccc(NC(=O)Nc2cc(Cl)cc(Cl)c2)cn1 |
| InChI | InChI=1S/C12H10Cl2N4O/c13-7-3-8(14)5-10(4-7)18-12(19)17-9-1-2-11(15)16-6-9/h1-6H,(H2,15,16)(H2,17,18,19) |
| InChIKey | XWNODGMHWRLGDJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |