C13H10Cl3N3O2 — CID 90211641
1-(4-aminooxy-3-chlorophenyl)-3-(3,5-dichlorophenyl)urea (PubChem CID 90211641) has the molecular formula C13H10Cl3N3O2 and a molecular weight of 346.60 g/mol. Its IUPAC name is 1-(4-aminooxy-3-chlorophenyl)-3-(3,5-dichlorophenyl)urea.
| Compound Name | 1-(4-aminooxy-3-chlorophenyl)-3-(3,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 90211641 |
| Molecular Formula | C13H10Cl3N3O2 |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | 1-(4-aminooxy-3-chlorophenyl)-3-(3,5-dichlorophenyl)urea |
| SMILES | NOc1ccc(NC(=O)Nc2cc(Cl)cc(Cl)c2)cc1Cl |
| InChI | InChI=1S/C13H10Cl3N3O2/c14-7-3-8(15)5-10(4-7)19-13(20)18-9-1-2-12(21-17)11(16)6-9/h1-6H,17H2,(H2,18,19,20) |
| InChIKey | BHRVWLDFXQQUIK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|