C13H8Cl2N4O2 — CID 167797088
1-(2,1,3-benzoxadiazol-5-yl)-3-(3,5-dichlorophenyl)urea (PubChem CID 167797088) has the molecular formula C13H8Cl2N4O2 and a molecular weight of 323.14 g/mol. Its IUPAC name is 1-(2,1,3-benzoxadiazol-5-yl)-3-(3,5-dichlorophenyl)urea.
| Compound Name | 1-(2,1,3-benzoxadiazol-5-yl)-3-(3,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 167797088 |
| Molecular Formula | C13H8Cl2N4O2 |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 1-(2,1,3-benzoxadiazol-5-yl)-3-(3,5-dichlorophenyl)urea |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)Nc1ccc2nonc2c1 |
| InChI | InChI=1S/C13H8Cl2N4O2/c14-7-3-8(15)5-10(4-7)17-13(20)16-9-1-2-11-12(6-9)19-21-18-11/h1-6H,(H2,16,17,20) |
| InChIKey | YHDBZKKDPIZSTA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |