C16H11Cl2N3O2 — CID 108812735
1-(3,5-dichlorophenyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea (PubChem CID 108812735) has the molecular formula C16H11Cl2N3O2 and a molecular weight of 348.19 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 108812735 |
| Molecular Formula | C16H11Cl2N3O2 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)Nc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C16H11Cl2N3O2/c17-11-6-12(18)8-13(7-11)19-16(22)20-15-9-14(23-21-15)10-4-2-1-3-5-10/h1-9H,(H2,19,20,21,22) |
| InChIKey | MYJPISKXTMAZLX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |