C16H13N3O3 — CID 108812516
1-(4-hydroxyphenyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea (PubChem CID 108812516) has the molecular formula C16H13N3O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-(4-hydroxyphenyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 108812516 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 1-(4-hydroxyphenyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea |
| SMILES | O=C(Nc1ccc(O)cc1)Nc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C16H13N3O3/c20-13-8-6-12(7-9-13)17-16(21)18-15-10-14(22-19-15)11-4-2-1-3-5-11/h1-10,20H,(H2,17,18,19,21) |
| InChIKey | AGEDFJLFWKSJLC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|