C16H10F3N3O2 — CID 108812789
1-(5-phenyl-1,2-oxazol-3-yl)-3-(2,3,4-trifluorophenyl)urea (PubChem CID 108812789) has the molecular formula C16H10F3N3O2 and a molecular weight of 333.27 g/mol. Its IUPAC name is 1-(5-phenyl-1,2-oxazol-3-yl)-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-(5-phenyl-1,2-oxazol-3-yl)-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 108812789 |
| Molecular Formula | C16H10F3N3O2 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 1-(5-phenyl-1,2-oxazol-3-yl)-3-(2,3,4-trifluorophenyl)urea |
| SMILES | O=C(Nc1cc(-c2ccccc2)on1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H10F3N3O2/c17-10-6-7-11(15(19)14(10)18)20-16(23)21-13-8-12(24-22-13)9-4-2-1-3-5-9/h1-8H,(H2,20,21,22,23) |
| InChIKey | BZSAXTDCWSWHMH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|