C18H17N3O2 — CID 108812645
1-(4-ethylphenyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea (PubChem CID 108812645) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-(4-ethylphenyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 108812645 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 1-(4-ethylphenyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea |
| SMILES | CCc1ccc(NC(=O)Nc2cc(-c3ccccc3)on2)cc1 |
| InChI | InChI=1S/C18H17N3O2/c1-2-13-8-10-15(11-9-13)19-18(22)20-17-12-16(23-21-17)14-6-4-3-5-7-14/h3-12H,2H2,1H3,(H2,19,20,21,22) |
| InChIKey | JOPBFLSNVGWCAA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |