C23H20N4O2 — CID 50827438
1-(4-ethylphenyl)-3-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]urea (PubChem CID 50827438) has the molecular formula C23H20N4O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]urea.
| Compound Name | 1-(4-ethylphenyl)-3-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 50827438 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 1-(4-ethylphenyl)-3-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]urea |
| SMILES | CCc1ccc(NC(=O)Nc2ccc(-c3nnc(-c4ccccc4)o3)cc2)cc1 |
| InChI | InChI=1S/C23H20N4O2/c1-2-16-8-12-19(13-9-16)24-23(28)25-20-14-10-18(11-15-20)22-27-26-21(29-22)17-6-4-3-5-7-17/h3-15H,2H2,1H3,(H2,24,25,28) |
| InChIKey | KPRZWUWCKSZBER-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |