C18H19N3O — CID 110653733
4-ethyl-N-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]aniline (PubChem CID 110653733) has the molecular formula C18H19N3O and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-ethyl-N-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]aniline.
| Compound Name | 4-ethyl-N-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 110653733 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 4-ethyl-N-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]aniline |
| SMILES | CCc1ccc(NCCc2nnc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C18H19N3O/c1-2-14-8-10-16(11-9-14)19-13-12-17-20-21-18(22-17)15-6-4-3-5-7-15/h3-11,19H,2,12-13H2,1H3 |
| InChIKey | DCVQZABNHVUBHC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |